![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A Drug Against War.mp3 | 2006-01-12 08:58 | 3.4M | |
| A Hole In The Wall.mp3 | 2006-01-12 08:58 | 5.3M | |
| Blood Evil-Mix.mp3 | 2006-01-12 08:58 | 4.8M | |
| Glory.mp3 | 2006-01-12 08:58 | 3.6M | |
| Light.mp3 | 2006-01-12 08:58 | 5.6M | |
| Lust.mp3 | 2006-01-12 08:58 | 4.0M | |
| Move On.mp3 | 2006-01-12 08:58 | 5.1M | |
| No Peace.mp3 | 2006-01-12 08:58 | 4.1M | |
| Sucks.mp3 | 2006-01-12 08:58 | 3.2M | |
| The Problem.mp3 | 2006-01-12 08:58 | 5.6M | |