![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - Intro.mp3 | 2013-05-31 03:39 | 969K | |
| 02 - And Then You Ki..> | 2013-05-31 03:47 | 7.1M | |
| 03 - Erase And Rewin..> | 2013-05-31 03:43 | 4.9M | |
| 04 - You're The Stor..> | 2013-05-31 03:44 | 5.5M | |
| 05 - Interview.mp3 | 2013-05-31 03:47 | 9.6M | |
| 06 - For What It's W..> | 2013-05-31 03:44 | 7.5M | |
| 07 - Communication.mp3 | 2013-05-31 03:46 | 8.4M | |
| 08 - My Favourite Ga..> | 2013-05-31 03:45 | 5.9M | |
| 09 - Outro.mp3 | 2013-05-31 03:39 | 1.1M | |