![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 08-Roller Monkey.mkv | 2019-01-05 04:50 | 130M | |
| 07-George in the Dar..> | 2019-01-05 04:53 | 90M | |
| 03-George Files a Ki..> | 2019-01-05 05:02 | 135M | |
| 05-Curious George - ..> | 2019-01-05 05:05 | 119M | |
| 04-George Finds His ..> | 2019-01-05 05:53 | 119M | |
| 06-George Goes up th..> | 2019-01-05 06:02 | 156M | |
| 02-George and the Da..> | 2019-01-05 06:19 | 137M | |
| 01-George's Rocket R..> | 2019-01-05 06:20 | 114M | |